CAS 13006-29-6
:1,2-Undecanediol
Description:
1,2-Undecanediol, with the CAS number 13006-29-6, is a linear aliphatic diol characterized by its two hydroxyl (-OH) functional groups located at the first and second carbon atoms of a straight-chain undecane. This compound is a colorless, viscous liquid at room temperature and is known for its hygroscopic properties, allowing it to absorb moisture from the environment. It has a relatively high boiling point and low volatility, making it suitable for various applications, including as a solvent, plasticizer, and in the formulation of personal care products. 1,2-Undecanediol exhibits moderate toxicity and is generally considered safe for use in cosmetics and pharmaceuticals when used appropriately. Its chemical structure contributes to its ability to act as a surfactant and emulsifier, enhancing the stability and texture of formulations. Additionally, it is biodegradable, which makes it an environmentally friendly option compared to some other synthetic compounds. Overall, 1,2-Undecanediol is valued for its multifunctional properties in both industrial and consumer applications.
Formula:C11H24O2
InChI:InChI=1S/C11H24O2/c1-2-3-4-5-6-7-8-9-11(13)10-12/h11-13H,2-10H2,1H3
InChI key:InChIKey=BUMVVNKGNPPUME-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)C(CO)O
Synonyms:- NSC 71469
- 1,2-Undecanediol
- 1,2-Undecylene glycol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
