CAS 13006-69-4
:lincosamine
Description:
Lincosamine, with the CAS number 13006-69-4, is a chemical compound that is structurally related to the antibiotic lincomycin. It is characterized by its amino sugar structure, which contributes to its biological activity. Lincosamine exhibits antibacterial properties, primarily targeting Gram-positive bacteria, and is often studied for its potential therapeutic applications. The compound is soluble in water and exhibits moderate stability under physiological conditions. Its mechanism of action involves inhibition of bacterial protein synthesis, making it effective against certain infections. Additionally, lincosamine may have implications in research related to antibiotic resistance and the development of new antimicrobial agents. As with many antibiotics, the use of lincosamine is subject to careful consideration regarding dosage and potential side effects, emphasizing the importance of responsible use in clinical settings. Overall, lincosamine represents a significant compound in the field of medicinal chemistry, particularly in the context of antibiotic development and microbial resistance.
Formula:C8H17NO6
InChI:InChI=1/C8H17NO6/c1-2(10)3(9)7-5(12)4(11)6(13)8(14)15-7/h2-8,10-14H,9H2,1H3/t2-,3-,4+,5-,6-,7-,8?/m1/s1
Synonyms:- D-erythro-D-galacto-Octopyranose, 6-amino-6,8-dideoxy-
- 6-amino-6,8-dideoxy-D-erythro-D-galacto-octopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Lincosamine
CAS:<p>Lincosamine is a lincosamide antibiotic produced by Streptomyces lincolnensis.</p>Formula:C8H17NO6Color and Shape:SolidMolecular weight:223.22Lincosamine
CAS:<p>Lincosamine is a nitrogen nucleophile that reacts with the electrophilic carbon of an activated aromatic ring in a chemical reaction. Lincosamine has been shown to be effective against infectious diseases caused by bacteria, such as Staphylococcus and Streptococcus, but not against viruses. The glycosidic bond between lincosamine and glucose is stereoselective. Lincosamine binds to the hybridoma cell strain through its monoclonal antibody and can be used for pharmacokinetic properties studies. Lincosamine has been used as an antimicrobial agent in biological samples such as urine, blood, and sputum.</p>Formula:C8H17NO6Purity:Min. 95%Molecular weight:223.22 g/mol

