
CAS 130064-18-5
:1-[2-[4-(3-Phenyl-2H-1-benzopyran-2-yl)phenoxy]ethyl]piperidine
Description:
1-[2-[4-(3-Phenyl-2H-1-benzopyran-2-yl)phenoxy]ethyl]piperidine, with the CAS number 130064-18-5, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and a benzopyran moiety. This compound features a phenoxy group and a phenyl substituent, contributing to its potential biological activity. The presence of the benzopyran structure suggests that it may exhibit properties similar to flavonoids, which are known for their antioxidant and anti-inflammatory effects. The piperidine ring can influence the compound's pharmacological properties, potentially affecting its interaction with biological targets. Such compounds are often investigated for their therapeutic potential in various medical applications, including neuroprotection and cardiovascular health. The solubility, stability, and reactivity of this compound would depend on its specific functional groups and overall molecular architecture, making it a subject of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C28H29NO2
InChI:InChI=1S/C28H29NO2/c1-3-9-22(10-4-1)26-21-24-11-5-6-12-27(24)31-28(26)23-13-15-25(16-14-23)30-20-19-29-17-7-2-8-18-29/h1,3-6,9-16,21,28H,2,7-8,17-20H2
InChI key:InChIKey=DBHGMZQRJDUFGS-UHFFFAOYSA-N
SMILES:O(CCN1CCCCC1)C2=CC=C(C3C(=CC=4C(O3)=CC=CC4)C5=CC=CC=C5)C=C2
Synonyms:- Piperidine, 1-[2-[4-(3-phenyl-2H-1-benzopyran-2-yl)phenoxy]ethyl]-
- CDRI 85/287
- 1-[2-[4-(3-Phenyl-2H-1-benzopyran-2-yl)phenoxy]ethyl]piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Piperidine, 1-[2-[4-(3-phenyl-2H-1-benzopyran-2-yl)phenoxy]ethyl]-
CAS:Formula:C28H29NO2Molecular weight:411.5354
