
CAS 130066-57-8
:1,3-Bis[4-(ethenyloxy)butyl] 1,3-benzenedicarboxylate
Description:
1,3-Bis[4-(ethenyloxy)butyl] 1,3-benzenedicarboxylate, with CAS number 130066-57-8, is an organic compound characterized by its structure, which includes a benzene ring substituted with two carboxylate groups and two 4-(ethenyloxy)butyl side chains. This compound is typically classified as a diester due to the presence of two ester functional groups derived from the reaction of a dicarboxylic acid and an alcohol. It exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the ethenyloxy groups, which can participate in polymerization reactions. The compound may be used in various applications, including as a monomer in the synthesis of polymers or as an intermediate in organic synthesis. Its physical properties, such as melting point, boiling point, and specific reactivity, would depend on the molecular interactions and the environment in which it is used. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C20H26O6
InChI:InChI=1S/C20H26O6/c1-3-23-12-5-7-14-25-19(21)17-10-9-11-18(16-17)20(22)26-15-8-6-13-24-4-2/h3-4,9-11,16H,1-2,5-8,12-15H2
InChI key:InChIKey=KZYBDOUJLUPBEH-UHFFFAOYSA-N
SMILES:C(OCCCCOC=C)(=O)C1=CC(C(OCCCCOC=C)=O)=CC=C1
Synonyms:- 4010SF
- 1,3-Benzenedicarboxylic acid, bis[4-(ethenyloxy)butyl] ester
- 1,3-Bis[4-(ethenyloxy)butyl] 1,3-benzenedicarboxylate
- 1,3-Benzenedicarboxylic acid, 1,3-bis[4-(ethenyloxy)butyl] ester
- VEctomer 4010
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3-Benzenedicarboxylic acid, 1,3-bis[4-(ethenyloxy)butyl] ester
CAS:Formula:C20H26O6Molecular weight:362.4168
