CAS 13007-92-6
:Chromium hexacarbonyl
Description:
Chromium hexacarbonyl, with the chemical formula Cr(CO)6 and CAS number 13007-92-6, is a coordination compound of chromium. It is characterized by its octahedral geometry, where a central chromium atom is surrounded by six carbon monoxide (CO) ligands. This compound is typically a volatile, yellow solid at room temperature and is known for its high reactivity and toxicity. Chromium hexacarbonyl is soluble in organic solvents such as benzene and toluene but is less soluble in water. It is often used in organic synthesis and as a precursor for chromium-containing materials. The compound is sensitive to air and moisture, leading to the formation of chromium oxides and carbon dioxide upon exposure. Due to its toxic nature, proper safety precautions must be taken when handling chromium hexacarbonyl, as it can pose health risks through inhalation or skin contact. Its unique properties make it a subject of interest in coordination chemistry and industrial applications.
Formula:C6CrO6
InChI:InChI=1S/6CO.Cr/c6*1-2;
InChI key:InChIKey=KOTQLLUQLXWWDK-UHFFFAOYSA-N
SMILES:[Cr](C#O)(C#O)(C#O)(C#O)(C#O)C#O
Synonyms:- Chromium carbonyl
- Chromium carbonyl (Cr(CO)6)
- Chromium carbonyl (Cr(CO)6), (OC-6-11)-
- Chromium carbonyl (Cr(CO)<sub>6</sub>)
- Chromium carbonyl (Cr(CO)<sub>6</sub>), (OC-6-11)-
- Chromium hexacarbonyl
- Chromium(0) hexacarbonyl
- Hexacarbonilcromo
- Hexacarbonylchrom
- Hexacarbonylchrome
- Hexacarbonylchromium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Hexacarbonylchromium, 99%
CAS:Hexacarbonylchromium is widely used as a catalyst for isomerization of alkenes. It is involved in the hydrogenation of 1,3-conjugated dienes and oxidation of allylic and benzylic positions. It acts as a precursor to prepare phenanthrenes, tricarbonyl(arene)chromium and Fischer carbine complexes. Thi
Formula:C6CrO6Purity:99%Molecular weight:220.06Chromium carbonyl, sublimed, 99%
CAS:Chromium carbonyl, sublimed, 99%
Formula:Cr(CO)6Purity:99%Color and Shape:white xtl.Molecular weight:220.06Chromium carbonyl (Cr(CO)6), (OC-6-11)-
CAS:Formula:C6CrO6Purity:99%Color and Shape:SolidMolecular weight:220.0567Ref: IN-DA000TZE
1g28.00€5g74.00€10g107.00€1kgTo inquire25g176.00€50g320.00€5kgTo inquire100g613.00€250gTo inquireChromium(0) hexacarbonyl
CAS:Formula:Cr(CO)6Purity:≥ 98.0%Color and Shape:White to yellow powder or crystalsMolecular weight:220.06Chromium hexacarbonyl
CAS:Chromium hexacarbonylPurity:99%Color and Shape:Beige SolidMolecular weight:220.0567g/mol
