CymitQuimica logo

CAS 1300730-22-6

:

1-[4-(2-Hydroxyethyl)-1-piperidinyl]-2-(2-thienyl)ethanone

Description:
1-[4-(2-Hydroxyethyl)-1-piperidinyl]-2-(2-thienyl)ethanone, identified by its CAS number 1300730-22-6, is a chemical compound characterized by its unique structural features. It contains a piperidine ring substituted with a hydroxyethyl group, which contributes to its potential solubility in polar solvents. The presence of a thienyl group indicates that the compound has aromatic characteristics, which may influence its reactivity and interaction with biological systems. This compound is likely to exhibit moderate to high lipophilicity due to the thienyl moiety, affecting its pharmacokinetic properties. Additionally, the hydroxyl group may impart hydrogen-bonding capabilities, enhancing its interactions with other molecules. The overall molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. However, specific biological activities, toxicity, and stability would require further investigation through empirical studies.
Formula:C13H19NO2S
InChI:InChI=1S/C13H19NO2S/c15-8-5-11-3-6-14(7-4-11)13(16)10-12-2-1-9-17-12/h1-2,9,11,15H,3-8,10H2
InChI key:InChIKey=LAVVHNDKLGGBFQ-UHFFFAOYSA-N
SMILES:C(CC1=CC=CS1)(=O)N2CCC(CCO)CC2
Synonyms:
  • 1-[4-(2-Hydroxyethyl)piperidin-1-yl]-2-(thiophen-2-yl)ethanone
  • 1-[4-(2-Hydroxyethyl)-1-piperidinyl]-2-(2-thienyl)ethanone
  • Ethanone, 1-[4-(2-hydroxyethyl)-1-piperidinyl]-2-(2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.