CAS 13009-91-1

Tripropylenemelamine

Description:

Tripropylenemelamine, with the CAS number 13009-91-1, is a chemical compound that belongs to the class of melamine derivatives. It is characterized by its structure, which includes multiple propylene groups attached to a melamine backbone. This compound is typically used as a crosslinking agent in various applications, including coatings, adhesives, and plastics, due to its ability to enhance thermal stability and mechanical properties. Tripropylenemelamine exhibits good resistance to heat and chemicals, making it suitable for use in demanding environments. Additionally, it can improve the durability and performance of materials by promoting stronger interfacial bonding. The compound is generally considered to have low toxicity, but safety precautions should still be observed during handling and application. Its versatility and effectiveness in enhancing material properties make it a valuable component in industrial formulations. As with any chemical, proper storage and disposal methods should be followed to minimize environmental impact and ensure safety.

Formula: C₁₂H₁₈N₆

InChI: InChI=1S/C12H18N6/c1-7-4-16(7)10-13-11(17-5-8(17)2)15-12(14-10)18-6-9(18)3/h7-9H,4-6H2,1-3H3

InChI key: InChIKey=IRIIKYVSZMJVNX-UHFFFAOYSA-N

SMILES: CC1N(C=2N=C(N=C(N2)N3C(C)C3)N4C(C)C4)C1

Synonyms:

• 2,4,6-Tris(2-methyl-1-aziridinyl)-s-triazine
• 2,4,6-Tris(2′-methyl-1′-aziridinyl)-1,3,5-triazine
• s-Triazine, 2,4,6-tris(2-methyl-1-aziridinyl)-
• 1,3,5-Triazine, 2,4,6-tris(2-methyl-1-aziridinyl)-
• 2,4,6-Tris(2-methyl-1-aziridinyl)-1,3,5-triazine

1,3,5-Triazine, 2,4,6-tris(2-methyl-1-aziridinyl)-

CAS: 13009-91-1

Formula: C₁₂H₁₈N₆

Molecular weight: 246.3115

Ref: IN-DA000U02