CAS 13009-95-5
:2′-Deoxy-5-(hydroxymethyl)-5′-cytidylic acid
Description:
2′-Deoxy-5-(hydroxymethyl)-5′-cytidylic acid, also known as 5-hydroxymethyl-2′-deoxycytidine monophosphate (5-hmC-dCMP), is a nucleotide derivative characterized by the presence of a hydroxymethyl group at the 5-position of the cytosine base. This compound plays a significant role in the structure and function of nucleic acids, particularly in the context of DNA modification and epigenetics. It is a key intermediate in the synthesis of 5-hydroxymethylcytosine, which is involved in gene regulation and cellular differentiation. The presence of the hydroxymethyl group can influence the stability and reactivity of the nucleotide, affecting its interactions with enzymes and other biomolecules. 2′-Deoxy-5-(hydroxymethyl)-5′-cytidylic acid is typically found in biological systems and can be synthesized through various biochemical pathways. Its study is important for understanding DNA methylation patterns and their implications in health and disease, particularly in cancer research and developmental biology.
Formula:C10H16N3O8P
InChI:InChI=1S/C10H16N3O8P/c11-9-5(3-14)2-13(10(16)12-9)8-1-6(15)7(21-8)4-20-22(17,18)19/h2,6-8,14-15H,1,3-4H2,(H2,11,12,16)(H2,17,18,19)/t6-,7+,8+/m0/s1
InChI key:InChIKey=BTIWPBKNTZFNRI-XLPZGREQSA-N
SMILES:O=C1N(C=C(CO)C(N)=N1)[C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)C2
Synonyms:- 5-Hydroxymethyldeoxycytidine monophosphate
- Cytidine, 2′-deoxy-5-(hydroxymethyl)-, 5′-(dihydrogen phosphate)
- 5-Hydroxymethylcytosine deoxyribonucleotide
- 5′-Cytidylic acid, 2′-deoxy-5-(hydroxymethyl)-
- 2′-Deoxy-5-(hydroxymethyl)-5′-cytidylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
