CAS 1301-20-8
:3',3'',5',5''-tetrabromophenolphthalein
Description:
3',3'',5',5''-Tetrabromophenolphthalein, with the CAS number 1301-20-8, is a synthetic organic compound that belongs to the class of brominated phenolphthalein derivatives. It is characterized by the presence of four bromine atoms substituted on the phenolic rings, which significantly alters its chemical properties compared to non-brominated phenolphthalein. This compound typically exhibits a strong color change in response to pH variations, making it useful as a pH indicator in various chemical applications. In acidic conditions, it appears colorless, while in alkaline conditions, it transitions to a distinct color, often pink or red, depending on the concentration and specific conditions. The presence of bromine enhances its stability and solubility in organic solvents. Additionally, 3',3'',5',5''-tetrabromophenolphthalein is utilized in analytical chemistry and various industrial applications, including dye manufacturing and as a reagent in biochemical assays. However, due to its brominated nature, it may pose environmental and health risks, necessitating careful handling and disposal.
Formula:C20H10Br4O4
InChI:InChI=1/C20H10Br4O4/c21-13-5-9(6-14(22)17(13)25)20(10-7-15(23)18(26)16(24)8-10)12-4-2-1-3-11(12)19(27)28-20/h1-8,25-26H
SMILES:c1ccc2c(c1)C(=O)OC2(c1cc(c(c(c1)Br)O)Br)c1cc(c(c(c1)Br)O)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
