
CAS 1301-35-5
:Docosanoic acid, 13,14-dibromo-, calcium salt (2:1)
Description:
Docosanoic acid, 13,14-dibromo-, calcium salt (2:1), also known as calcium 13,14-dibromodocosanoate, is a chemical compound characterized by its long-chain fatty acid structure, specifically derived from docosanoic acid (a 22-carbon saturated fatty acid). The presence of bromine atoms at the 13th and 14th positions introduces halogenated characteristics, which can influence its reactivity and solubility. As a calcium salt, it typically exhibits properties associated with ionic compounds, such as higher melting points and solubility in polar solvents. This compound may be utilized in various applications, including as a surfactant or in the synthesis of other chemical products. Its unique structure can also impart specific biological activities, making it of interest in biochemical research. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, the compound's characteristics are defined by its fatty acid backbone, halogenation, and ionic nature due to the calcium salt formation.
Formula:C22H42Br2O2Ca
InChI:InChI=1S/C22H42Br2O2.Ca/c1-2-3-4-5-11-14-17-20(23)21(24)18-15-12-9-7-6-8-10-13-16-19-22(25)26;/h20-21H,2-19H2,1H3,(H,25,26);
InChI key:InChIKey=UZEXXHCWENSVGY-UHFFFAOYSA-N
SMILES:C(C(CCCCCCCC)Br)(CCCCCCCCCCCC(O)=O)Br.[Ca]
Synonyms:- Calcium dibromobehenate
- Docosanoic acid, 13,14-dibromo-, calcium salt (2:1)
- Docosanoic acid, 13,14-dibromo-, calcium salt
- Calbroben
- Sabromin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Docosanoic acid, 13,14-dibromo-, calcium salt (2:1)
CAS:Formula:C44H82Br4CaO4Molecular weight:1034.8135
