CAS 13010-10-1
:N′-Nitro-N-nitroso-N-pentylguanidine
Description:
N′-Nitro-N-nitroso-N-pentylguanidine, identified by its CAS number 13010-10-1, is a chemical compound that belongs to the class of nitro and nitroso derivatives of guanidine. It is characterized by the presence of both nitro (-NO2) and nitroso (-N=O) functional groups attached to a pentyl-substituted guanidine backbone. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on its specific structure and substituents. N′-Nitro-N-nitroso-N-pentylguanidine is of interest in various fields, including medicinal chemistry and materials science, due to its potential reactivity and applications in synthesis. However, it is essential to handle this compound with care, as nitro and nitroso compounds can be sensitive to heat and light, and may pose health risks if not managed properly. As with many chemical substances, understanding its reactivity, stability, and safety profile is crucial for its effective use in research and industry.
Formula:C6H13N5O3
InChI:InChI=1S/C6H13N5O3/c1-2-3-4-5-10(9-12)6(7)8-11(13)14/h2-5H2,1H3,(H2,7,8)
InChI key:InChIKey=OKMNBMCHWAWZBL-UHFFFAOYSA-N
SMILES:N(C(NN(=O)=O)=N)(CCCCC)N=O
Synonyms:- N′-Nitro-N-nitroso-N-pentylguanidine
- Guanidine, N′-nitro-N-nitroso-N-pentyl-
- Guanidine, 3-nitro-1-nitroso-1-pentyl-
- N-Amyl-N-nitroso-N′-nitroguanidine
- NSC 34699
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
