
CAS 13010-31-6
:Tetrapropylammonium
Description:
Tetrapropylammonium, with the CAS number 13010-31-6, is a quaternary ammonium compound characterized by its four propyl groups attached to a central nitrogen atom. This structure imparts a positive charge to the nitrogen, making it a cationic species. Tetrapropylammonium is typically encountered as a salt, often in the form of tetrapropylammonium bromide or tetrapropylammonium chloride, which are commonly used in various chemical applications. The compound is known for its solubility in organic solvents and limited solubility in water, reflecting its hydrophobic nature due to the long hydrocarbon chains. It exhibits surfactant properties, making it useful in applications such as phase transfer catalysis, where it facilitates the transfer of reactants between immiscible phases. Additionally, tetrapropylammonium can be employed in the synthesis of ionic liquids and as a reagent in organic synthesis. Its stability and relatively low toxicity make it a valuable compound in both industrial and laboratory settings.
Formula:C12H28N
InChI:InChI=1S/C12H28N/c1-5-9-13(10-6-2,11-7-3)12-8-4/h5-12H2,1-4H3/q+1
InChI key:InChIKey=OSBSFAARYOCBHB-UHFFFAOYSA-N
SMILES:[N+](CCC)(CCC)(CCC)CCC
Synonyms:- 1-Propanaminium, N,N,N-tripropyl-
- Tetrapropylammonium ion
- Tetrapropylammonium
- N,N,N-Tripropyl-1-propanaminium
- Ammonium, tetrapropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
