CymitQuimica logo

CAS 130112-51-5

:

Propanedioic acid, 2-(1,3-dithietan-2-ylidene)-, 1-(1-methylethyl) ester

Description:
Propanedioic acid, 2-(1,3-dithietan-2-ylidene)-, 1-(1-methylethyl) ester, identified by CAS number 130112-51-5, is an organic compound characterized by its unique structure that includes a propanedioic acid moiety and a 1,3-dithietan ring. This compound features a dithiacyclopentane structure, which contributes to its distinct chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the ester functional group indicates that it can undergo hydrolysis to form the corresponding acid and alcohol. Its molecular structure suggests potential applications in organic synthesis and materials science, particularly in the development of novel polymers or as intermediates in chemical reactions. Additionally, the compound may exhibit interesting reactivity due to the presence of sulfur atoms in the dithietan ring, which can influence its chemical behavior and interactions with other substances. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C8H10O4S2
InChI:InChI=1S/C8H10O4S2/c1-4(2)12-7(11)5(6(9)10)8-13-3-14-8/h4H,3H2,1-2H3,(H,9,10)
InChI key:InChIKey=DXVLACTYUUKEGY-UHFFFAOYSA-N
SMILES:C(C(OC(C)C)=O)(C(O)=O)=C1SCS1
Synonyms:
  • Propanedioic acid, 2-(1,3-dithietan-2-ylidene)-, 1-(1-methylethyl) ester
  • 2-(1,3-Dithietan-2-ylidene)-3-oxo-3-(propan-2-yloxy)propanoic acid
  • 1,3-Dithietane, propanedioic acid deriv.
  • Propanedioic acid, 1,3-dithietan-2-ylidene-, mono(1-methylethyl) ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.