CAS 130115-65-0
:1,1′-[(1-Methylethyl)imino]bis[3-(1H-indol-4-yloxy)[2-propanol]
Description:
1,1′-[(1-Methylethyl)imino]bis[3-(1H-indol-4-yloxy)[2-propanol], commonly referred to by its CAS number 130115-65-0, is a chemical compound characterized by its complex structure, which includes an imino group and indole moieties. This compound typically exhibits properties associated with both indole derivatives and alcohol functionalities, suggesting potential biological activity. The presence of the indole ring may contribute to its pharmacological properties, as indole derivatives are often found in various natural products and pharmaceuticals. The compound's solubility, stability, and reactivity can be influenced by the presence of the isopropyl group and the alcohol functionalities, which may also affect its interaction with biological targets. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy and chromatography, to confirm its structure and purity. Overall, this compound may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C25H31N3O4
InChI:InChI=1S/C25H31N3O4/c1-17(2)28(13-18(29)15-31-24-7-3-5-22-20(24)9-11-26-22)14-19(30)16-32-25-8-4-6-23-21(25)10-12-27-23/h3-12,17-19,26-27,29-30H,13-16H2,1-2H3
InChI key:InChIKey=BLCDDLOHQZZMHH-UHFFFAOYSA-N
SMILES:O(CC(CN(CC(COC1=C2C(NC=C2)=CC=C1)O)C(C)C)O)C3=C4C(NC=C4)=CC=C3
Synonyms:- 1,1′-[(1-Methylethyl)imino]bis[3-(1H-indol-4-yloxy)[2-propanol]
- 2-Propanol, 1,1′-[(1-methylethyl)imino]bis[3-(1H-indol-4-yloxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
1,1'-[(1-Methylethyl)imino]bis[3-(1H-indol-4-yloxy)propan-2-ol]
CAS:Controlled ProductFormula:C25H31N3O4Color and Shape:NeatMolecular weight:437.531,1'-[(1-Methylethyl)imino]bis[3-(1H-indol-4-yloxy)-2-propanol
CAS:Controlled Product<p>Applications Pindolol (P468000) impurity.<br></p>Formula:C25H31N3O4Color and Shape:NeatMolecular weight:437.53



