CAS 130115-85-4

2-Chloro-3-Bromo-5-Hydroxypyridine

Description:

2-Chloro-3-Bromo-5-Hydroxypyridine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with chlorine, bromine, and hydroxyl functional groups. The molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The chlorine and bromine substituents introduce halogen functionalities that can influence the compound's reactivity, making it suitable for various chemical transformations. The hydroxyl group provides hydrogen bonding capabilities, enhancing its solubility in polar solvents and affecting its biological activity. This compound may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical research. Additionally, its unique combination of substituents can lead to diverse applications in organic synthesis and materials science. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact. Overall, 2-Chloro-3-Bromo-5-Hydroxypyridine is a versatile compound with significant implications in both industrial and research settings.

Formula: C₅H₃BrClNO

InChI: InChI=1/C5H3BrClNO/c6-4-1-3(9)2-8-5(4)7/h1-2,9H

SMILES: c1c(cnc(c1Br)Cl)O

Synonyms:

• 5-Bromo-6-Chloropyridin-3-Ol

3-Pyridinol, 5-bromo-6-chloro-

CAS: 130115-85-4

Formula: C₅H₃BrClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.4404

Ref: IN-DA000U1C

3-Bromo-2-chloro-5-hydroxypyridine

CAS: 130115-85-4

3-Bromo-2-chloro-5-hydroxypyridine

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.44g/mol

Ref: 54-OR345245

5-Bromo-6-chloropyridin-3-ol

CAS: 130115-85-4

Formula: C₅H₃BrClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.44

Ref: 10-F217595