CymitQuimica logo

CAS 1301214-77-6

:

Methyl 7-bromo-2,3-dihydro-2-oxo-1H-benzimidazole-5-carboxylate

Description:
Methyl 7-bromo-2,3-dihydro-2-oxo-1H-benzimidazole-5-carboxylate is a chemical compound characterized by its complex structure, which includes a benzimidazole core, a carboxylate ester, and a bromine substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the bromine atom may enhance its reactivity and influence its pharmacological properties. The carboxylate group contributes to its acidity and potential for forming salts or participating in esterification reactions. Additionally, the dihydro and keto functionalities suggest that it may engage in various chemical transformations, making it of interest in synthetic organic chemistry and medicinal chemistry. Its specific applications may vary, but compounds of this type are often explored for their potential therapeutic effects, including antimicrobial or anticancer activities. As with many chemical substances, safety and handling precautions are essential due to the presence of bromine and the potential for biological activity.
Formula:C9H7BrN2O3
InChI:InChI=1S/C9H7BrN2O3/c1-15-8(13)4-2-5(10)7-6(3-4)11-9(14)12-7/h2-3H,1H3,(H2,11,12,14)
InChI key:InChIKey=YWKSHESIUHOPDK-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(C(OC)=O)=C1)NC(=O)N2
Synonyms:
  • Methyl 7-bromo-2,3-dihydro-2-oxo-1H-benzimidazole-5-carboxylate
  • 1H-Benzimidazole-5-carboxylic acid, 7-bromo-2,3-dihydro-2-oxo-, methyl ester
  • 7-Bromo-2-oxo-2,3-dihydro-1H-benzoimidazole-5-carboxylic acid methyl ester
  • methyl 7-bromo-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylate
Found 3 products.