CAS 130129-59-8
:5-Chloro-6-ethyl-4-pyrimidinamine
Description:
5-Chloro-6-ethyl-4-pyrimidinamine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 5-position and an ethyl group at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It may exhibit basic properties due to the amino group at the 4-position, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. 5-Chloro-6-ethyl-4-pyrimidinamine is of interest in medicinal chemistry and agricultural applications, often serving as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Its reactivity and functional groups make it a versatile building block in organic synthesis, and it may also exhibit biological activity, although specific biological properties would depend on the context of its use. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H8ClN3
InChI:InChI=1S/C6H8ClN3/c1-2-4-5(7)6(8)10-3-9-4/h3H,2H2,1H3,(H2,8,9,10)
InChI key:InChIKey=OWYYGBFPJMRGCG-UHFFFAOYSA-N
SMILES:C(C)C=1C(Cl)=C(N)N=CN1
Synonyms:- 5-Chloro-6-ethyl-4-pyrimidinamine
- 4-Pyrimidinamine, 5-chloro-6-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
