CAS 130137-05-2

4,5-DIFLUORO-2-IODOBENZOIC ACID

Description:

4,5-Difluoro-2-iodobenzoic acid is an aromatic carboxylic acid characterized by the presence of two fluorine atoms and one iodine atom substituted on a benzene ring. The molecular structure features a carboxylic acid functional group (-COOH) that imparts acidic properties, making it soluble in polar solvents. The presence of the electronegative fluorine and iodine atoms influences the compound's reactivity and polarity, potentially enhancing its ability to participate in electrophilic substitution reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique halogen substitutions can also affect its biological activity and interaction with other chemical entities. Additionally, 4,5-difluoro-2-iodobenzoic acid may exhibit specific melting and boiling points, which are important for its handling and application in laboratory settings. Safety data should be consulted to ensure proper handling, as halogenated compounds can pose health risks.

Formula: C₇H₃F₂IO₂

InChI: InChI=1/C7H3F2IO2/c8-4-1-3(7(11)12)6(10)2-5(4)9/h1-2H,(H,11,12)

SMILES: c1c(c(cc(c1F)F)I)C(=O)O

Synonyms:

• Buttpark 144\07-17

Benzoic acid, 4,5-difluoro-2-iodo-

CAS: 130137-05-2

Formula: C₇H₃F₂IO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 283.9988

Ref: IN-DA000U1R

4,5-Difluoro-2-iodobenzoic acid

CAS: 130137-05-2

4,5-Difluoro-2-iodobenzoic acid

Formula: C₇H₃F₂IO₂

Purity: ≥95%

Color and Shape: white powder

Molecular weight: 284.00g/mol

Ref: 54-PC6916

4,5-Difluoro-2-iodobenzoic acid

CAS: 130137-05-2

Formula: C₇H₃F₂IO₂

Purity: 97%

Molecular weight: 284

Ref: 10-F033203