CAS 130156-62-6
:2-Methyl-1-(8-quinolinyl)-3-penten-1-one
Description:
2-Methyl-1-(8-quinolinyl)-3-penten-1-one, with the CAS number 130156-62-6, is an organic compound characterized by its unique structure that includes a quinoline moiety and a conjugated enone system. This compound typically exhibits a yellow to brown color and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic nature. The presence of the quinoline ring contributes to its potential biological activity, making it of interest in medicinal chemistry and research. The compound may display properties such as fluorescence, which can be useful in various applications, including as a fluorescent probe or in photochemical studies. Additionally, its reactivity can be influenced by the presence of the double bond and the carbonyl group, allowing for potential participation in various chemical reactions, such as nucleophilic additions or cycloadditions. Overall, 2-Methyl-1-(8-quinolinyl)-3-penten-1-one is a compound of interest for its structural features and potential applications in chemical and biological research.
Formula:C15H15NO
InChI:InChI=1S/C15H15NO/c1-3-6-11(2)15(17)13-9-4-7-12-8-5-10-16-14(12)13/h3-11H,1-2H3
InChI key:InChIKey=QOVWQXWEGKGLKF-UHFFFAOYSA-N
SMILES:C(C(C=CC)C)(=O)C=1C2=C(C=CC1)C=CC=N2
Synonyms:- 2-Methyl-1-(8-quinolinyl)-3-penten-1-one
- 3-Penten-1-one, 2-methyl-1-(8-quinolinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
