CAS 13017-47-5
:(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazine
Description:
(4,6-Dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazine, with the CAS number 13017-47-5, is a chemical compound characterized by its unique structure that includes a triazine ring and morpholine groups. This compound typically exhibits properties associated with both hydrazine derivatives and triazine-based compounds, which may include moderate solubility in polar solvents and potential reactivity due to the presence of hydrazine functional groups. It is often studied for its applications in agricultural chemistry, particularly as a potential herbicide or fungicide, owing to its ability to interact with biological systems. The morpholine moiety may contribute to its biological activity and solubility characteristics. Additionally, compounds of this nature can exhibit various biological activities, including antimicrobial and antifungal properties. Safety and handling precautions are essential, as hydrazine derivatives can be toxic and potentially hazardous. Overall, (4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)hydrazine represents a class of compounds with significant potential in both industrial and research applications.
Formula:C11H19N7O2
InChI:InChI=1/C11H19N7O2/c12-16-9-13-10(17-1-5-19-6-2-17)15-11(14-9)18-3-7-20-8-4-18/h1-8,12H2,(H,13,14,15,16)
Synonyms:- 2-Hydrazino-4,6-di(morpholin-4-yl)-1,3,5-triazine
- 2-hydrazinyl-4,6-di(morpholin-4-yl)-1,3,5-triazine
- morpholine, 4,4'-(6-hydrazinyl-1,3,5-triazine-2,4-diyl)bis-
- (2E)-2-Hydrazono-4,6-di(morpholin-4-yl)-1,2-dihydro-1,3,5-triazine
- 1,3,5-triazin-2(1H)-one, 4,6-di-4-morpholinyl-, hydrazone, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
