CymitQuimica logo

CAS 13017-69-1

:

3-methyl-3-propylcyclopropane-1,1,2,2-tetracarbonitrile

Description:
3-Methyl-3-propylcyclopropane-1,1,2,2-tetracarbonitrile, with the CAS number 13017-69-1, is a chemical compound characterized by its unique structure, which includes a cyclopropane ring substituted with both methyl and propyl groups, along with four cyano (nitrile) functional groups. This compound is typically a colorless to pale yellow solid at room temperature and exhibits a relatively high melting point due to the presence of multiple nitrile groups, which contribute to its polarity and potential for strong intermolecular interactions. The cyano groups impart significant reactivity, making it a useful intermediate in organic synthesis and materials science. Additionally, the presence of the cyclopropane ring introduces strain, which can influence the compound's reactivity and stability. Its unique structural features may also lead to interesting physical properties, such as solubility in polar solvents. Overall, 3-methyl-3-propylcyclopropane-1,1,2,2-tetracarbonitrile is a notable compound in the field of organic chemistry, particularly for applications involving nitrile chemistry.
Formula:C11H10N4
InChI:InChI=1/C11H10N4/c1-3-4-9(2)10(5-12,6-13)11(9,7-14)8-15/h3-4H2,1-2H3
SMILES:CCCC1(C)C(C#N)(C#N)C1(C#N)C#N
Synonyms:
  • 1,1,2,2-Cyclopropanetetracarbonitrile, 3-methyl-3-propyl-
  • 3-Methyl-3-propylcyclopropane-1,1,2,2-tetracarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.