CAS 1301706-42-2

1,2-Ethanediamine, 1,2-di-3-pyridinyl-, hydrochloride (1:4), (1R,2R)-

Description:

1,2-Ethanediamine, 1,2-di-3-pyridinyl-, hydrochloride (1:4), (1R,2R)- is a chemical compound characterized by its dual amine functionality and pyridine substituents. This compound features a backbone of ethanediamine, which consists of two amine groups (-NH2) attached to a two-carbon chain, with each amine group substituted by a pyridine ring. The presence of the hydrochloride indicates that the compound is in its salt form, which enhances its solubility in water and may influence its biological activity. The (1R,2R) designation refers to the specific stereochemistry of the molecule, indicating that it has a defined three-dimensional arrangement that can affect its reactivity and interaction with biological systems. This compound may exhibit properties typical of both amines and pyridine derivatives, such as potential basicity and the ability to form hydrogen bonds. Its applications could span various fields, including pharmaceuticals and materials science, although specific uses would depend on further research into its biological and chemical behavior.

Formula: C₁₂H₁₄N₄·4ClH

InChI: InChI=1S/C12H14N4.4ClH/c13-11(9-3-1-5-15-7-9)12(14)10-4-2-6-16-8-10;;;;/h1-8,11-12H,13-14H2;4*1H/t11-,12-;;;;/m1..../s1

InChI key: InChIKey=GAHCWAYKHBFBHN-WVNQDYSFSA-N

SMILES: [C@@H]([C@H](N)C=1C=CC=NC1)(N)C=2C=CC=NC2.Cl

Synonyms:

• 1,2-Ethanediamine, 1,2-di-3-pyridinyl-, hydrochloride (1:4), (1R,2R)-
• (1R,2R)-1,2-Dipyridin-3-ylethane-1,2-diamine tetrahydrochloride
• (R,R)-1,2-Bis(3-pyridyl)-1,2-ethanediamine tetrahydrochloride