CymitQuimica logo

CAS 1301738-64-6

:

4-(Trifluoromethoxy)proline

Description:
4-(Trifluoromethoxy)proline is an amino acid derivative characterized by the presence of a trifluoromethoxy group attached to the proline backbone. This compound features a five-membered pyrrolidine ring, typical of proline, which contributes to its unique structural properties. The trifluoromethoxy group enhances the molecule's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and drug design. The presence of fluorine atoms can also impart distinctive electronic properties, potentially affecting the compound's reactivity and interactions with biological targets. Additionally, 4-(Trifluoromethoxy)proline may exhibit specific solubility characteristics in various solvents, which is crucial for its application in pharmaceutical formulations. Its synthesis typically involves the introduction of the trifluoromethoxy group through various organic reactions, and the compound may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, this compound represents a valuable tool in the exploration of proline analogs and their potential therapeutic applications.
Formula:C6H8F3NO3
InChI:InChI=1S/C6H8F3NO3/c7-6(8,9)13-3-1-4(5(11)12)10-2-3/h3-4,10H,1-2H2,(H,11,12)
InChI key:InChIKey=KNQAAVYPDKAZPC-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1CC(C(O)=O)NC1
Synonyms:
  • 4-(Trifluoromethoxy)proline
  • Proline, 4-(trifluoromethoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.