CAS 1301738-69-1

Methanone, 3-piperidinyl-3-pyridinyl-, hydrochloride (1:2)

Description:

Methanone, 3-piperidinyl-3-pyridinyl-, hydrochloride (1:2), with the CAS number 1301738-69-1, is a chemical compound characterized by its unique structure that includes both piperidine and pyridine moieties. This compound typically appears as a hydrochloride salt, which enhances its solubility in water and other polar solvents. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological effects. The pyridine component may also influence its electronic properties and reactivity. As a hydrochloride salt, it is likely to exhibit stability under standard conditions, making it suitable for various applications in research and development. The compound's specific interactions, such as binding affinity to biological targets, would depend on its molecular conformation and the functional groups present. Overall, Methanone, 3-piperidinyl-3-pyridinyl-, hydrochloride (1:2) represents a class of compounds that may have implications in medicinal chemistry and drug design.

Formula: C₁₁H₁₄N₂O·2ClH

InChI: InChI=1S/C11H14N2O.2ClH/c14-11(9-3-1-5-12-7-9)10-4-2-6-13-8-10;;/h1,3,5,7,10,13H,2,4,6,8H2;2*1H

InChI key: InChIKey=JLMGPDAQJNHIAN-UHFFFAOYSA-N

SMILES: C(=O)(C1CCCNC1)C=2C=CC=NC2.Cl

Synonyms:

• Methanone, 3-piperidinyl-3-pyridinyl-, hydrochloride (1:2)