CAS 1301739-71-8

4H-1,2,4-Triazole-3-methanamine, 4-ethyl-α-methyl-, hydrochloride (1:2)

Description:

4H-1,2,4-Triazole-3-methanamine, 4-ethyl-α-methyl-, hydrochloride (1:2) is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically exhibits properties associated with triazoles, such as potential antifungal and antimicrobial activity, making it of interest in pharmaceutical applications. The presence of the ethyl and α-methyl groups contributes to its hydrophobic characteristics, which can influence its solubility and bioavailability. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various formulations. The compound's molecular interactions may involve hydrogen bonding due to the amine group, which can play a role in its biological activity. Overall, this compound's unique structural features and functional groups suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₆H₁₂N₄·2ClH

InChI: InChI=1S/C6H12N4.2ClH/c1-3-10-4-8-9-6(10)5(2)7;;/h4-5H,3,7H2,1-2H3;2*1H

InChI key: InChIKey=LZQFJZSBTHUHKT-UHFFFAOYSA-N

SMILES: C(C)N1C(C(C)N)=NN=C1.Cl

Synonyms:

• 4H-1,2,4-Triazole-3-methanamine, 4-ethyl-α-methyl-, hydrochloride (1:2)