CAS 1301739-72-9

6-Quinolinemethanamine, 1,2,3,4-tetrahydro-N-methyl-1-(1-methylethyl)-, ethanedioate (1:1)

Description:

6-Quinolinemethanamine, 1,2,3,4-tetrahydro-N-methyl-1-(1-methylethyl)-, ethanedioate (1:1), identified by its CAS number 1301739-72-9, is a chemical compound that features a quinoline ring structure, which is known for its aromatic properties and biological activity. This substance is characterized by the presence of a tetrahydro derivative, indicating it has undergone partial hydrogenation, resulting in a saturated cyclic structure. The N-methyl and isopropyl substituents contribute to its steric and electronic properties, potentially influencing its reactivity and interaction with biological systems. The ethanedioate component suggests that the compound forms a salt or complex with oxalic acid, which may enhance its solubility and stability in various solvents. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, solubility, and biological activity, would require empirical investigation for detailed understanding.

Formula: C₁₄H₂₂N₂·C₂H₂O₄

InChI: InChI=1S/C14H22N2.C2H2O4/c1-11(2)16-8-4-5-13-9-12(10-15-3)6-7-14(13)16;3-1(4)2(5)6/h6-7,9,11,15H,4-5,8,10H2,1-3H3;(H,3,4)(H,5,6)

InChI key: InChIKey=SUGQGIDHGYHUNJ-UHFFFAOYSA-N

SMILES: C(C)(C)N1C=2C(=CC(CNC)=CC2)CCC1.C(C(O)=O)(O)=O

Synonyms:

• 6-Quinolinemethanamine, 1,2,3,4-tetrahydro-N-methyl-1-(1-methylethyl)-, ethanedioate (1:1)

[(1-isopropyl-1,2,3,4-tetrahydro-6-quinolinyl)methyl]methylamine oxalate

CAS: 1301739-72-9

Formula: C₁₆H₂₄N₂O₄

Purity: 95.0%

Molecular weight: 308.378

Ref: 10-F360993