CAS 13018-10-5
:Torilin
Description:
Torilin, with the CAS number 13018-10-5, is a chemical compound that belongs to the class of natural products known as terpenoids. It is primarily derived from certain plant sources and is recognized for its potential biological activities. Torilin exhibits a complex molecular structure, which contributes to its unique properties. It is often studied for its potential applications in pharmacology, particularly for its anti-inflammatory and antioxidant effects. The compound may also demonstrate antimicrobial properties, making it of interest in the development of new therapeutic agents. In terms of physical characteristics, Torilin is typically a colorless to pale yellow liquid, with a specific odor that can vary depending on its source. Its solubility can vary in different solvents, which is an important factor for its application in various formulations. As with many natural compounds, further research is ongoing to fully elucidate its mechanisms of action and potential uses in medicine and industry.
Formula:C22H32O5
InChI:InChI=1S/C22H32O5/c1-8-12(2)21(25)26-20-9-13(3)16-11-19(24)14(4)17(16)10-18(20)22(6,7)27-15(5)23/h8,13,16,18,20H,9-11H2,1-7H3/b12-8-/t13-,16+,18-,20+/m0/s1
InChI key:InChIKey=IQWVFAXBJQKUDH-TXCQZRSTSA-N
SMILES:[C@@](OC(C)=O)(C)(C)[C@@H]1[C@H](OC(/C(=C\C)/C)=O)C[C@H](C)[C@@]2(C(C1)=C(C)C(=O)C2)[H]
Synonyms:- 1β-Guai-4-en-3-one, 8β,11-dihydroxy-, 11-acetate 2-methylcrotonate, (Z)-
- 2-Butenoic acid, 2-methyl-, (5S,6R,8S,8aR)-5-[1-(acetyloxy)-1-methylethyl]-1,2,4,5,6,7,8,8a-octahydro-3,8-dimethyl-2-oxo-6-azulenyl ester, (2Z)-
- 2-Butenoic acid, 2-methyl-, 5-[1-(acetyloxy)-1-methylethyl]-1,2,4,5,6,7,8,8a-octahydro-3,8-dimethyl-2-oxo-6-azulenyl ester, [5S-[5α,6α(Z),8α,8aα]]-
- Torilin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Butenoic acid, 2-methyl-, (5S,6R,8S,8aR)-5-[1-(acetyloxy)-1-methylethyl]-1,2,4,5,6,7,8,8a-octahydro-3,8-dimethyl-2-oxo-6-azulenyl ester, (2Z)-
CAS:Formula:C22H32O5Purity:90%Color and Shape:SolidMolecular weight:376.4865Torilin
CAS:Torilin is an inhibitor of testosterone 5 alpha-reductase, it (IC50 = 31.7 +/- 4.23 microM) shows a stronger inhibition of 5 alpha-reductase than alpha-Formula:C22H32O5Purity:98%Color and Shape:SolidMolecular weight:376.49[(5S,8S,8aR)-5-(2-Acetyloxypropan-2-yl)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-6-yl] (Z)-2-methylbut-2-enoate
CAS:[(5S,8S,8aR)-5-(2-Acetyloxypropan-2-yl)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-6-yl] (Z)-2-methylbut-2-enoate is a bioactive compound that serves as a semi-synthetic derivative of a naturally occurring substance found predominantly in certain species of the Artemisia plant. Known for their diverse range of secondary metabolites, Artemisia species have been extensively studied for their various therapeutic properties. The compound operates by interfering with vital biochemical pathways in microbial cells, leading to disruptions in cell wall synthesis and protein function, ultimately resulting in the inhibition of microbial growth and proliferation.Formula:C22H32O5Purity:Min. 95%Molecular weight:376.5 g/mol



