CAS 13018-41-2
:1,1′-(1,4-Butanediyl) bis(3-oxobutanoate)
Description:
1,1′-(1,4-Butanediyl) bis(3-oxobutanoate), also known by its CAS number 13018-41-2, is an organic compound characterized by its structure, which features two 3-oxobutanoate groups linked by a 1,4-butanediyl chain. This compound is typically a white to off-white solid at room temperature and is soluble in polar organic solvents. It exhibits properties typical of esters, including the potential for hydrolysis under acidic or basic conditions, leading to the release of the corresponding carboxylic acids. The presence of carbonyl groups in its structure contributes to its reactivity, making it a candidate for various chemical transformations, including condensation reactions. Additionally, it may have applications in the synthesis of polymers or as an intermediate in organic synthesis due to its functional groups. Its stability and reactivity can be influenced by environmental factors such as temperature and pH, which are important considerations in its handling and application in chemical processes.
Formula:C12H18O6
InChI:InChI=1S/C12H18O6/c1-9(13)7-11(15)17-5-3-4-6-18-12(16)8-10(2)14/h3-8H2,1-2H3
InChI key:InChIKey=IHSFHIUGYHMYNR-UHFFFAOYSA-N
SMILES:C(C(OCCCCOC(CC(C)=O)=O)=O)C(C)=O
Synonyms:- 1,4-Butanediol bis(acetoacetate)
- 3-Oxobutyric acid 4-(3-oxobutyryloxy)butyl ester
- Butanoic acid, 3-oxo-, 1,1′-(1,4-butanediyl) ester
- 1,1′-(1,4-Butanediyl) bis(3-oxobutanoate)
- Tetramethylene bis(acetoacetate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
