CAS 13018-60-5

N-[5-(tert-butylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide

Description:

N-[5-(tert-butylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a sulfonamide functional group. This compound typically exhibits properties associated with both the thiadiazole and sulfonamide classes, such as potential antimicrobial and anti-inflammatory activities. The presence of the tert-butylsulfamoyl group enhances its solubility and stability, making it suitable for various applications in medicinal chemistry. The acetamide moiety contributes to its ability to form hydrogen bonds, which can influence its biological interactions. Additionally, the compound may exhibit moderate to high polarity due to the functional groups present, affecting its distribution and absorption in biological systems. Overall, N-[5-(tert-butylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide represents a class of compounds that may be explored for therapeutic uses, particularly in the development of new pharmaceuticals targeting specific biological pathways.

Formula: C₈H₁₄N₄O₃S₂

InChI: InChI=1/C8H14N4O3S2/c1-5(13)9-6-10-11-7(16-6)17(14,15)12-8(2,3)4/h12H,1-4H3,(H,9,10,13)

SMILES: CC(=Nc1nnc(s1)S(=O)(=O)NC(C)(C)C)O

N-[5-(tert-Butylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide

CAS: 13018-60-5

N-[5-(tert-Butylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide is a sulfonilamide that inhibits the activity of an enzyme known as dehydrogenase. N-[5-(tert-Butylsulfamoyl)-1,3,4-thiadiazol-2-yl]acetamide has been shown to be effective against ganglia and bladder cancer cells. It can also inhibit the activity of an enzyme called carbonic anhydrase II and may have use in the treatment of renal calculi. The drug is not active against other types of cancer cells or normal cells.

Formula: C₈H₁₄N₄O₃S₂

Purity: Min. 95%

Molecular weight: 278.4 g/mol

Ref: 3D-NAA01860