CymitQuimica logo

CAS 130182-29-5

:

ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate

Description:
Ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate is a heterocyclic compound characterized by its complex structure, which includes an imidazole ring fused with a thiazole moiety. This compound features a carboxylate functional group and an ethyl ester, contributing to its chemical reactivity and potential applications in various fields, including medicinal chemistry. The presence of the methyl group on the imidazole ring can influence its biological activity and solubility. Ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate is of interest in research due to its potential role in the synthesis of bioactive molecules and its implications in the study of mutagenicity and carcinogenicity, particularly in food chemistry, as certain imidazole derivatives are known to be formed during the cooking of certain foods. Its CAS number, 130182-29-5, allows for precise identification in chemical databases, facilitating research and development efforts involving this compound.
Formula:C9H10N2O2S
InChI:InChI=1/C9H10N2O2S/c1-3-13-8(12)7-6(2)11-5-4-10-9(11)14-7/h4-5H,3H2,1-2H3
Synonyms:
  • Ethyl 3-methylimidazo[2,1-b][1,3]thiazole-2-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.