CAS 130182-31-9

Imidazo[2,1-b]thiazole-5-carboxaldehyde

Description:

Imidazo[2,1-b]thiazole-5-carboxaldehyde is a heterocyclic organic compound characterized by its fused imidazole and thiazole rings, which contribute to its unique chemical properties. This compound features a carboxaldehyde functional group, making it reactive and capable of participating in various chemical reactions, such as condensation and nucleophilic addition. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the aldehyde group. The compound is of interest in medicinal chemistry and material science, often investigated for its potential biological activities, including antimicrobial and anticancer properties. Its structure allows for various modifications, which can enhance its pharmacological profile. Additionally, the presence of nitrogen and sulfur in its rings can influence its electronic properties, making it a candidate for applications in organic electronics and as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₄N₂OS

InChI: InChI=1S/C6H4N2OS/c9-4-5-3-7-6-8(5)1-2-10-6/h1-4H

InChI key: InChIKey=FLDROJNUHIOZBM-UHFFFAOYSA-N

SMILES: C(=O)C=1N2C(=NC1)SC=C2

Synonyms:

• Imidazo[2,1-b]thiazole-5-carboxaldehyde
• NSC 355031

Imidazo[2,1-b][1,3]thiazole-5-carbaldehyde

CAS: 130182-31-9

Versatile small molecule scaffold

Formula: C₆H₄N₂OS

Purity: Min. 95%

Molecular weight: 152.18 g/mol

Ref: 3D-FFA18231