CAS 130182-37-5

Imidazo[2,1-b]thiazole-5-methanol

Description:

Imidazo[2,1-b]thiazole-5-methanol is a heterocyclic organic compound characterized by its fused imidazole and thiazole rings, which contribute to its unique chemical properties. This compound typically exhibits a molecular structure that includes a hydroxymethyl group (-CH2OH) at the 5-position of the thiazole ring, enhancing its reactivity and potential for forming hydrogen bonds. Imidazo[2,1-b]thiazoles are known for their biological activity, often serving as scaffolds in medicinal chemistry for developing pharmaceuticals, particularly in the fields of antimicrobial and anticancer agents. The presence of both nitrogen and sulfur atoms in the ring system can influence the compound's electronic properties, solubility, and interaction with biological targets. Additionally, the compound may exhibit moderate to high stability under standard conditions, although specific reactivity can vary based on substituents and environmental factors. Overall, Imidazo[2,1-b]thiazole-5-methanol represents a significant class of compounds with diverse applications in chemical and pharmaceutical research.

Formula: C₆H₆N₂OS

InChI: InChI=1S/C6H6N2OS/c9-4-5-3-7-6-8(5)1-2-10-6/h1-3,9H,4H2

InChI key: InChIKey=CGNHKTWBASPCLB-UHFFFAOYSA-N

SMILES: C(O)C=1N2C(=NC1)SC=C2

Synonyms:

• Imidazo[2,1-b]thiazole-5-methanol

{Imidazo[2,1-b][1,3]thiazol-5-yl}methanol

CAS: 130182-37-5

Versatile small molecule scaffold

Formula: C₆H₆N₂OS

Purity: Min. 95%

Molecular weight: 154.19 g/mol

Ref: 3D-FFA18237