
CAS 13019-19-7
:2-Methyl-1-hepten-3-ol
Description:
2-Methyl-1-hepten-3-ol, with the CAS number 13019-19-7, is an organic compound classified as an alcohol due to the presence of a hydroxyl (-OH) functional group. It features a branched carbon chain, specifically a heptene structure, indicating the presence of a double bond in the carbon chain. This compound is characterized by its hydrophobic nature, typical of many aliphatic alcohols, and exhibits moderate solubility in water due to the hydroxyl group. It has a distinctive odor, often described as floral or fruity, making it of interest in the fragrance and flavor industries. The compound is also known for its potential applications in organic synthesis and as a building block in the production of various chemical derivatives. Its reactivity is influenced by both the alcohol and alkene functionalities, allowing for various chemical transformations. Safety data indicates that, like many organic solvents, it should be handled with care to avoid inhalation or skin contact.
Formula:C8H16O
InChI:InChI=1S/C8H16O/c1-4-5-6-8(9)7(2)3/h8-9H,2,4-6H2,1,3H3
InChI key:InChIKey=PPKIOOAEILEYAF-UHFFFAOYSA-N
SMILES:C(C(C)=C)(CCCC)O
Synonyms:- 3-Hydroxy-2-methyl-1-heptene
- 1-Hepten-3-ol, 2-methyl-
- 2-Methyl-1-hepten-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
