CAS 13019-53-9
:anapterin
Description:
Anapterin, with the CAS number 13019-53-9, is a chemical compound that belongs to the class of pteridines, which are bicyclic compounds containing a pyrimidine and a pyrazine ring. It is characterized by its role as a cofactor in various biological processes, particularly in the metabolism of folate and related compounds. Anapterin is known for its involvement in the synthesis of nucleic acids and amino acids, making it significant in cellular functions. The compound exhibits solubility in water and is typically stable under standard laboratory conditions. Its structure includes multiple functional groups that contribute to its reactivity and interactions with other biomolecules. Anapterin's biological activity and potential applications in biochemistry and pharmacology are subjects of ongoing research, particularly in understanding its role in cellular metabolism and potential therapeutic uses. Overall, anapterin is an important compound in the field of biochemistry, with implications for both fundamental research and potential clinical applications.
Formula:C9H11N5O3
InChI:InChI=1/C9H11N5O3/c1-3(15)6(16)4-2-11-5-7(12-4)13-9(10)14-8(5)17/h2-3,6,15-16H,1H3,(H3,10,12,13,14,17)/t3-,6-/m1/s1
SMILES:C[C@H]([C@H](c1cnc2c(n1)[nH]c(=N)nc2O)O)O
Synonyms:- 7-Isoneopterin
- D-erythro-7-Isoneopterin
- 4(1H)-Pteridinone, 2-amino-7-(1,2-dihydroxypropyl)-, (R-(R*,S*))-
- 2-amino-7-[(1S,2R)-1,2-dihydroxypropyl]pteridin-4(1H)-one
- Anapterin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Anapterin
CAS:<p>Anapterin is an analog of capsaicin, a compound found in chili peppers. It acts as an inhibitor of kinases, which are enzymes involved in cell signaling and regulation. Anapterin has been shown to induce apoptosis (cell death) in cancer cells, making it a potential anticancer drug. In Chinese hamster ovary cells, Anapterin inhibited the activity of protein kinase C (PKC), leading to reduced cell proliferation and increased cell death. This compound has also been studied for its potential use as a urinary inhibitor for the prevention of kidney stones. Overall, Anapterin shows promise as a potent inhibitor with potential therapeutic applications in cancer treatment and other diseases involving abnormal kinase activity.</p>Formula:C9H11N5O3Purity:Min. 95%Molecular weight:237.22 g/mol

