CAS 13020-83-2
:9H-Purin-6-aminium, N,N,N-trimethyl-, chloride (1:1)
Description:
9H-Purin-6-aminium, N,N,N-trimethyl-, chloride (1:1), commonly known as trimethylated purine, is a quaternary ammonium compound characterized by its structure, which includes a purine base with three methyl groups attached to the nitrogen atom at the 6-position. This compound is typically encountered as a white crystalline solid and is soluble in water due to its ionic nature, attributed to the presence of the chloride ion. It exhibits basic properties due to the quaternary ammonium group, making it a potential candidate for various biochemical applications, including its role as a substrate or cofactor in enzymatic reactions. The compound is often studied in the context of nucleic acid chemistry and cellular metabolism, particularly in relation to its influence on cellular signaling pathways and gene expression. Safety data indicates that it should be handled with care, as with many chemical substances, to avoid potential hazards associated with its use.
Formula:C8H12N5·Cl
InChI:InChI=1S/C8H12N5.ClH/c1-13(2,3)8-6-7(10-4-9-6)11-5-12-8;/h4-5H,1-3H3,(H,9,10,11,12);1H/q+1;/p-1
InChI key:InChIKey=JSVIFNMHKUROQN-UHFFFAOYSA-M
SMILES:[N+](C)(C)(C)C1=C2C(=NC=N1)N=CN2.[Cl-]
Synonyms:- 9H-Purin-6-aminium, N,N,N-trimethyl-, chloride (1:1)
- 1H-Purin-6-aminium, N,N,N-trimethyl-, chloride
- Ammonium, trimethylpurin-6-yl-, chloride
- Purin-6-yltrimethyl ammonium chloride
- Trimethylpurin-6-ylammonium chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
