CymitQuimica logo

CAS 130200-58-7

:

7-HYDROXY-NAPHTHALENE-2-CARBONITRILE

Description:
7-Hydroxy-naphthalene-2-carbonitrile, with the CAS number 130200-58-7, is an organic compound characterized by its naphthalene backbone, which features a hydroxyl group (-OH) at the 7-position and a carbonitrile group (-C≡N) at the 2-position. This compound typically exhibits properties associated with both aromatic compounds and nitriles, such as stability and potential reactivity due to the presence of the carbonitrile functional group. The hydroxyl group can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. In terms of applications, compounds like 7-hydroxy-naphthalene-2-carbonitrile may be explored in fields such as pharmaceuticals, agrochemicals, or materials science due to their potential biological activity and utility in synthetic pathways. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of solvents or other reagents. Overall, this compound represents a versatile structure with potential implications in various chemical research areas.
Formula:C11H7NO
InChI:InChI=1/C11H7NO/c12-7-8-1-2-9-3-4-11(13)6-10(9)5-8/h1-6,13H
InChI key:NFBPHZSDBOVNAL-UHFFFAOYSA-N
SMILES:c1cc2ccc(cc2cc1C#N)O
Synonyms:
  • 2-Naphthalenecarbonitrile, 7-Hydroxy-
  • 7-Hydroxy-2-naphthonitrile
Found 4 products.