CymitQuimica logo

CAS 130200-70-3

:

1,2-Dihydro-1-methyl-6-(trifluoromethyl)-1,2,4-benzotriazine

Description:
1,2-Dihydro-1-methyl-6-(trifluoromethyl)-1,2,4-benzotriazine is a heterocyclic organic compound characterized by its unique structure, which includes a benzotriazine core with a trifluoromethyl group and a methyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. The compound may display significant stability under various conditions, making it suitable for applications in pharmaceuticals or agrochemicals. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Additionally, the presence of nitrogen atoms in the ring contributes to its chemical reactivity, potentially allowing for various substitution reactions. Overall, 1,2-Dihydro-1-methyl-6-(trifluoromethyl)-1,2,4-benzotriazine is a compound of interest in synthetic chemistry and medicinal chemistry due to its distinctive features and potential applications.
Formula:C9H8F3N3
InChI:InChI=1S/C9H8F3N3/c1-15-8-3-2-6(9(10,11)12)4-7(8)13-5-14-15/h2-5H,1H3,(H,13,14)
InChI key:InChIKey=BJZIAJMTOFVEDF-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(C(F)(F)F)=CC2)NC=N1
Synonyms:
  • 1,2,4-Benzotriazine, 1,2-dihydro-1-methyl-6-(trifluoromethyl)-
  • 1,2-Dihydro-1-methyl-6-(trifluoromethyl)-1,2,4-benzotriazine
  • 1-Methyl-6-(trifluoromethyl)-2H-1,2,4-benzotriazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.