CAS 130205-54-8
:(S)-Methyl 4-(Boc-(methyl)amino)-5-hydroxypentanoate
Description:
(S)-Methyl 4-(Boc-(methyl)amino)-5-hydroxypentanoate, with the CAS number 130205-54-8, is a chemical compound characterized by its chiral center, which contributes to its specific stereochemistry. The presence of the Boc (tert-butyloxycarbonyl) protecting group indicates that it is likely used in peptide synthesis or as an intermediate in organic synthesis, providing stability and protecting the amine functionality during reactions. The hydroxyl group in the pentanoate chain suggests potential for hydrogen bonding and reactivity, making it a versatile compound in various chemical contexts. Its methyl ester form implies that it can be hydrolyzed to yield the corresponding carboxylic acid, which may have different biological or chemical properties. Overall, this compound is significant in medicinal chemistry and organic synthesis, particularly in the development of pharmaceuticals where stereochemistry plays a crucial role in biological activity.
Formula:C12H23NO5
InChI:InChI=1/C12H23NO5/c1-12(2,3)18-11(16)13(4)9(8-14)6-7-10(15)17-5/h9,14H,6-8H2,1-5H3
SMILES:CC(C)(C)OC(=O)N(C)C(CCC(=O)OC)CO
Synonyms:- (S)-4-[[(tert-Butoxy)carbonyl]methylamino]-5-hydroxypentanoic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.