CAS 13021-02-8
:nitrocyclopropane
Description:
Nitrocyclopropane is a chemical compound characterized by its unique structure, which consists of a cyclopropane ring with a nitro group (-NO2) attached. This compound is known for its high energy content and potential applications in the field of explosives and propellants due to the presence of the nitro group, which can enhance its reactivity. Nitrocyclopropane is typically a colorless to pale yellow liquid, exhibiting a distinct odor. It is relatively unstable compared to other nitro compounds, making it sensitive to heat and shock, which poses handling risks. The compound is also polar, which influences its solubility in various solvents. Its synthesis often involves nitration reactions, and it can undergo further chemical transformations, including reduction and substitution reactions. Due to its energetic nature, nitrocyclopropane is of interest in both academic research and industrial applications, particularly in the development of new materials and energetic formulations. Safety precautions are essential when working with this compound due to its potential hazards.
Formula:C3H5NO2
InChI:InChI=1/C3H5NO2/c5-4(6)3-1-2-3/h3H,1-2H2
SMILES:C1CC1N(=O)=O
Synonyms:- Cyclopropane, Nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
