CAS 13021-15-3
:N,N,2,4,6-Pentamethylbenzenamine
Description:
N,N,2,4,6-Pentamethylbenzenamine, with the CAS number 13021-15-3, is an organic compound characterized by its amine functional group attached to a highly substituted aromatic ring. This compound features five methyl groups positioned at the 1, 2, 4, and 6 positions of the benzene ring, contributing to its steric bulk and influencing its chemical reactivity. The presence of the amine group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. N,N,2,4,6-Pentamethylbenzenamine is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its unique structure makes it useful in the synthesis of dyes, pharmaceuticals, and other organic compounds. Additionally, due to the presence of multiple methyl groups, it exhibits relatively low volatility and may have specific solubility characteristics in organic solvents. Safety data should be consulted, as amines can be hazardous, and appropriate handling procedures are necessary.
Formula:C11H17N
InChI:InChI=1S/C11H17N/c1-8-6-9(2)11(12(4)5)10(3)7-8/h6-7H,1-5H3
InChI key:InChIKey=JZBZLRKFJWQZHU-UHFFFAOYSA-N
SMILES:N(C)(C)C1=C(C)C=C(C)C=C1C
Synonyms:- 1-(N,N-Dimethylamino)-2,4,6-Trimethylbenzene
- 2,4,6,N,N-Pentamethylaniline
- 2-(Dimethylamino)mesitylene
- 2-Dimethylaminomesitylene
- Aniline, N,N,2,4,6-pentamethyl-
- Benzenamine,N,N,2,4,6-pentamethyl-
- Dimethyl-(2,4,6-trimethyl-phenyl)-amine
- N,N,2,4,6-Pentamethylbenzenamine
- N,N-Dimethylmesidine
- NSC 243164
- N,N,2,4,6-Pentamethylaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Benzenamine, N,N,2,4,6-pentamethyl-
CAS:Formula:C11H17NPurity:97%Color and Shape:LiquidMolecular weight:163.2594N,N,2,4,6-Pentamethylaniline, min. 99%
CAS:Formula:C11H17NPurity:min. 99%Color and Shape:Clear, colorless liquidMolecular weight:163.26N,N,2,4,6-Pentamethylaniline, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.</p>Formula:C11H17NPurity:98%Color and Shape:Clear, colorless, LiquidMolecular weight:163.26N,N,2,4,6-Pentamethylaniline
CAS:Formula:C11H17NPurity:99.0 min. %Color and Shape:Clear, colorless liquidMolecular weight:163.26N,N,2,4,6-Pentamethylaniline
CAS:Formula:C11H17NPurity:>97.0%(GC)Color and Shape:White to Yellow to Green clear liquidMolecular weight:163.26






