CAS 13021-40-4
:5-Cyclohexene-1,2,3,4-tetrone, 5,6-dihydroxy-, potassium salt (1:2)
Description:
5-Cyclohexene-1,2,3,4-tetrone, 5,6-dihydroxy-, potassium salt (1:2) is a chemical compound characterized by its unique structure, which includes a cyclohexene ring with multiple ketone and hydroxyl functional groups. This compound typically appears as a solid and is soluble in water due to the presence of hydroxyl groups, which enhance its polarity. The potassium salt form indicates that it is a salt derived from the neutralization of the acidic hydroxyl groups with potassium ions, which can influence its solubility and reactivity. The presence of multiple functional groups suggests potential applications in organic synthesis, pharmaceuticals, or as a reagent in various chemical reactions. Additionally, the compound may exhibit interesting biological activities, although specific biological properties would require further investigation. Its stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, this compound represents a complex organic structure with potential utility in various chemical and industrial applications.
Formula:C6H2O6·2K
InChI:InChI=1S/C6H2O6.2K/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h7-8H;;
InChI key:InChIKey=LCBGQMVPSDZJJJ-UHFFFAOYSA-N
SMILES:O=C1C(=O)C(=O)C(O)=C(O)C1=O.[K]
Synonyms:- 1,2-Dihydroxy-3,4,5,6-tetraoxocyclohexene dipotassium salt~Potassium rhodizonate
- 5-Cyclohexene-1,2,3,4-tetrone, 5,6-dihydroxy-, dipotassium salt
- 5-Cyclohexene-1,2,3,4-tetrone, 5,6-dihydroxy-, potassium salt (1:2)
- Dipotassium 3,4,5,6-Tetraoxocyclohex-1-Ene-1,2-Diolate
- Dipotassium rhodizonate
- Disodium 3,4,5,6-Tetraoxocyclohexene-1,2-Diolate
- Potassium rhodizonate
- Potassium, [(3,4,5,6,-tetraoxo-1-cyclohexen-1,2-ylene)dioxy]di-
- Rhodizonic Acid Potassium
- Rhodizonic acid, dipotassium deriv.
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Cyclohexene-1,2,3,4-tetrone, 5,6-dihydroxy-, potassium salt (1:2)
CAS:Formula:C6H4K2O6Purity:97%Color and Shape:SolidMolecular weight:250.2890Potassium 3,4,5,6-Tetraoxocyclohex-1-Ene-1,2-Bis(Olate)
CAS:Potassium 3,4,5,6-Tetraoxocyclohex-1-Ene-1,2-Bis(Olate)Purity:95%Molecular weight:246.26g/molPotassium Rhodizonate
CAS:Formula:C6K2O6Purity:>95.0%(T)Color and Shape:Black powder to crystalMolecular weight:246.26Rhodizonic acid dipotassium salt
CAS:Rhodizonic acid dipotassium salt is a solubilized dye that is used to stain acidic polysaccharides in the cell wall of bacteria. This compound has been shown to be useful in clinical studies for identifying colon cancer, as well as being used as a dietary supplement. Rhodizonic acid dipotassium salt contains nitrogen atoms and an oxidation product, malonic acid, which are found in a variety of biological systems. Rhodizonic acid dipotassium salt has been shown to have staining properties and is often used for the identification of bacteria with a simple staining technique. It can also be used to identify bacteria with more complicated techniques such as electrophoresis and chromatography. Rhodizonic acid dipotassium salt has been found to be rechargeable by treatment with chloride ions under acidic conditions.Formula:C6O6·2KPurity:Min. 95%Color and Shape:PowderMolecular weight:246.26 g/mol



