
CAS 13021-71-1
:4-Methyl-N-(phenylmethyl)-2-pyridinamine
Description:
4-Methyl-N-(phenylmethyl)-2-pyridinamine, with the CAS number 13021-71-1, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methyl group attached to the 4-position of the pyridine ring and a phenylmethyl (benzyl) group at the nitrogen atom, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its aromatic nature. The presence of both the methyl and phenylmethyl substituents can influence its reactivity, making it potentially useful in various chemical reactions, including those involving nucleophilic substitution or electrophilic aromatic substitution. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C13H14N2
InChI:InChI=1S/C13H14N2/c1-11-7-8-14-13(9-11)15-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,14,15)
InChI key:InChIKey=QHDJYTUZWBABGW-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)C2=CC(C)=CC=N2
Synonyms:- N-Benzyl-4-methylpyridin-2-amine
- 4-Picoline, 2-(benzylamino)-
- 2-(Benzylamino)-4-methylpyridine
- 2-Pyridinamine, 4-methyl-N-(phenylmethyl)-
- 4-Methyl-N-(phenylmethyl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
