CAS 13022-42-9

leucyl-leucine-methyl ester

Description:

Leucyl-leucine-methyl ester, with the CAS number 13022-42-9, is a dipeptide derivative formed from the amino acids leucine and leucine, with a methyl ester functional group. This compound is characterized by its hydrophobic nature due to the presence of leucine, which is a branched-chain amino acid known for its role in protein synthesis and metabolism. The methyl ester group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. Leucyl-leucine-methyl ester may exhibit biological activity, including potential roles in signaling pathways or as a substrate for enzymatic reactions. Its structural features allow it to participate in various chemical reactions, making it of interest in peptide synthesis and medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, leucyl-leucine-methyl ester serves as a valuable compound in biochemical research and applications, particularly in the study of peptide interactions and functions.

Formula: C₁₃H₂₆N₂O₃

InChI: InChI=1/C13H26N2O3/c1-4-6-8-10(14)12(16)15-11(9-7-5-2)13(17)18-3/h10-11H,4-9,14H2,1-3H3,(H,15,16)/t10-,11-/m0/s1

SMILES: CCCC[C@@H](C(=N[C@@H](CCCC)C(=O)OC)O)N

Synonyms:

• Leu-leu-ome
• L-Leucine, N-L-leucyl-, methyl ester
• methyl L-norleucyl-L-norleucinate

Leucylleucine methyl ester

CAS: 13022-42-9

Leucylleucine methyl ester is a drug potentially for the treatment of Graft-Versus-Host-Disease.

Formula: C₁₃H₂₆N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 258.36

Ref: TM-T27817