
CAS 13022-89-4
:α-Methyl-1-piperidinepropanamine
Description:
α-Methyl-1-piperidinepropanamine, also known by its CAS number 13022-89-4, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a propanamine side chain with a methyl group at the alpha position relative to the nitrogen atom in the piperidine ring. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific form. The presence of the amine functional group suggests that it can participate in hydrogen bonding, influencing its solubility in polar solvents. α-Methyl-1-piperidinepropanamine may exhibit basic properties due to the nitrogen atom, allowing it to act as a proton acceptor. Its structural characteristics may contribute to its potential applications in pharmaceuticals or as an intermediate in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H20N2
InChI:InChI=1S/C9H20N2/c1-9(10)5-8-11-6-3-2-4-7-11/h9H,2-8,10H2,1H3
InChI key:InChIKey=CHSYXGNAAHBZSJ-UHFFFAOYSA-N
SMILES:C(CC(C)N)N1CCCCC1
Synonyms:- Piperidine, 1-(3-aminobutyl)-
- 1-Piperidinepropanamine, α-methyl-
- α-Methyl-1-piperidinepropanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
