
CAS 13022-91-8
:Itaconimide
Description:
Itaconimide, with the CAS number 13022-91-8, is an organic compound derived from itaconic acid. It is characterized by its imide functional group, which contributes to its reactivity and potential applications in various chemical processes. Itaconimide typically appears as a white to off-white crystalline solid and is soluble in polar solvents. The compound exhibits interesting properties such as the ability to undergo polymerization, making it valuable in the synthesis of polymers and copolymers. Itaconimide is also noted for its potential use in pharmaceuticals and agrochemicals due to its biological activity. The presence of both double bonds and the imide group allows for diverse chemical transformations, enhancing its utility in organic synthesis. Additionally, itaconimide can serve as a building block for more complex molecules, contributing to its significance in materials science and medicinal chemistry. Overall, itaconimide is a versatile compound with a range of applications in both industrial and research settings.
Formula:C5H5NO2
InChI:InChI=1S/C5H5NO2/c1-3-2-4(7)6-5(3)8/h1-2H2,(H,6,7,8)
InChI key:InChIKey=FKAWETHEYBZGSR-UHFFFAOYSA-N
SMILES:C=C1C(=O)NC(=O)C1
Synonyms:- 3-Methylidenepyrrolidine-2,5-dione
- Succinimide, 2-methylene-
- 2,5-Pyrrolidinedione, 3-methylene-
- Itaconimide
- 3-Methylene-2,5-pyrrolidinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
