
CAS 130221-78-2
:4-[(1-Propen-1-yloxy)methyl]-1,3-dioxolan-2-one
Description:
4-[(1-Propen-1-yloxy)methyl]-1,3-dioxolan-2-one, with the CAS number 130221-78-2, is an organic compound characterized by its unique structure that includes a dioxolane ring and a propenyl ether functional group. This compound typically exhibits properties associated with both cyclic esters and ethers, which may influence its reactivity and stability. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the dioxolane moiety suggests potential applications in polymer chemistry, particularly in the synthesis of polyesters or as a monomer in various polymerization processes. Additionally, the propenyl group may allow for further functionalization through reactions such as polymerization or cross-linking. Its reactivity can be influenced by factors such as temperature and the presence of catalysts, making it a versatile compound in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H10O4
InChI:InChI=1S/C7H10O4/c1-2-3-9-4-6-5-10-7(8)11-6/h2-3,6H,4-5H2,1H3
InChI key:InChIKey=YFXXJQJIGQHZSG-UHFFFAOYSA-N
SMILES:C(OC=CC)C1OC(=O)OC1
Synonyms:- 1,3-Dioxolan-2-one, 4-[(1-propenyloxy)methyl]-
- Rapi-Cure PEPC
- 1,3-Dioxolan-2-one, 4-[(1-propen-1-yloxy)methyl]-
- 4-[(1-Propen-1-yloxy)methyl]-1,3-dioxolan-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
