CAS 13024-49-2
:4-(2-Phenylethyl)benzenamine
Description:
4-(2-Phenylethyl)benzenamine, also known as N-(2-phenylethyl)aniline, is an organic compound characterized by its amine functional group and a biphenyl structure. It features a phenyl group attached to a benzene ring through a two-carbon ethyl chain, which contributes to its unique properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the amine group allows for potential reactivity in various chemical reactions, including nucleophilic substitutions and coupling reactions. 4-(2-Phenylethyl)benzenamine may be used in the synthesis of dyes, pharmaceuticals, and other organic compounds. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to mitigate any potential hazards associated with this chemical.
Formula:C14H15N
InChI:InChI=1S/C14H15N/c15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-5,8-11H,6-7,15H2
InChI key:InChIKey=ZRPMISJEZSOSQC-UHFFFAOYSA-N
SMILES:C(CC1=CC=CC=C1)C2=CC=C(N)C=C2
Synonyms:- p-Phenethylaniline
- 4-(2-Phenylethyl)benzenamine
- 4-Aminodibenzyl
- Benzenamine, 4-(2-phenylethyl)-
- Aniline, p-phenethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
