
CAS 13025-07-5
:4-[(1-Oxo-2-propen-1-yl)oxy]butyl 3-oxobutanoate
Description:
4-[(1-Oxo-2-propen-1-yl)oxy]butyl 3-oxobutanoate, identified by its CAS number 13025-07-5, is an organic compound characterized by its ester functional group and a complex structure that includes both a butyl chain and a propenyl moiety. This compound typically exhibits properties associated with esters, such as being relatively non-polar, which can influence its solubility in organic solvents while being less soluble in water. The presence of the 3-oxobutanoate group suggests that it may participate in various chemical reactions, including esterification and condensation reactions. Additionally, the propenyl group indicates potential for polymerization or other reactions involving double bonds. Its molecular structure may confer specific reactivity and stability under certain conditions, making it of interest in synthetic organic chemistry and potentially in applications such as pharmaceuticals or agrochemicals. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.
Formula:C11H16O5
InChI:InChI=1S/C11H16O5/c1-3-10(13)15-6-4-5-7-16-11(14)8-9(2)12/h3H,1,4-8H2,2H3
InChI key:InChIKey=PICTWXAWDCLLKO-UHFFFAOYSA-N
SMILES:C(OCCCCOC(C=C)=O)(CC(C)=O)=O
Synonyms:- Butanoic acid, 3-oxo-, 4-[(1-oxo-2-propenyl)oxy]butyl ester
- Acrylic acid, 4-hydroxybutyl ester acetoacetate
- Acetoacetic acid, ester with 4-hydroxybutyl acrylate
- Butanoic acid, 3-oxo-, 4-[(1-oxo-2-propen-1-yl)oxy]butyl ester
- Acetoacetic acid, 4-hydroxybutyl ester acrylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Butanoic acid, 3-oxo-, 4-[(1-oxo-2-propen-1-yl)oxy]butyl ester
CAS:Formula:C11H16O5Molecular weight:228.2417
