CymitQuimica logo

CAS 130250-55-4

:

3-Piperidinecarboxamide, 1-formyl-

Description:
3-Piperidinecarboxamide, 1-formyl- is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxamide functional group and a formyl group, indicating the presence of both an amide and an aldehyde functional group. The molecular structure contributes to its potential reactivity and interactions in various chemical environments. Typically, compounds like this may exhibit properties such as solubility in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The presence of the formyl group may also influence its reactivity, making it a candidate for further chemical transformations. This compound may find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.
Formula:C7H12N2O2
InChI:InChI=1S/C7H12N2O2/c8-7(11)6-2-1-3-9(4-6)5-10/h5-6H,1-4H2,(H2,8,11)
InChI key:InChIKey=NADNERWNWVUWEZ-UHFFFAOYSA-N
SMILES:C(N)(=O)C1CN(C=O)CCC1
Synonyms:
  • 3-Piperidinecarboxamide, 1-formyl-
  • 1-Formylpiperidine-3-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.