CAS 13026-23-8
:3-[1,1′-Biphenyl]-4-yl-2-propenoic acid
Description:
3-[1,1′-Biphenyl]-4-yl-2-propenoic acid, also known as a derivative of cinnamic acid, is an organic compound characterized by its structure, which features a biphenyl group attached to a propenoic acid moiety. This compound typically exhibits properties associated with unsaturated carboxylic acids, including the ability to participate in various chemical reactions such as polymerization and esterification. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic biphenyl component. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to engage in acid-base reactions. Additionally, the compound may exhibit UV-Vis absorbance characteristics due to the conjugated double bond system, making it of interest in photochemical applications. Its potential uses could span across fields such as materials science, organic synthesis, and pharmaceuticals, particularly in the development of novel compounds with specific functional properties. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C15H12O2
InChI:InChI=1S/C15H12O2/c16-15(17)11-8-12-6-9-14(10-7-12)13-4-2-1-3-5-13/h1-11H,(H,16,17)
InChI key:InChIKey=DMJDEZUEYXVYNO-UHFFFAOYSA-N
SMILES:C(=CC(O)=O)C1=CC=C(C=C1)C2=CC=CC=C2
Synonyms:- (2E)-3-biphenyl-4-ylprop-2-enoic acid
- (2Z)-3-biphenyl-4-ylprop-2-enoic acid
- 2-Propenoic acid, 3-[1,1′-biphenyl]-4-yl-
- 3-(1,1′-Biphenyl-4-yl)acrylic acid
- 3-Biphenyl-4-ylacrylic acid
- 3-[1,1′-Biphenyl]-4-yl-2-propenoic acid
- 4-Phenylcinnamic acid
- Cinnamic acid, p-phenyl-
- [1,1′-Biphenyl]-4-acrylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Phenylcinnamic acid, 98%
CAS:4-Phenylcinnamic acid is used as pharmaceutical intermediates and for chemical research. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / iFormula:C15H12O2Purity:98%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:224.263-([1,1'-BIPHENYL]-4-YL)ACRYLIC ACID
CAS:Formula:C15H12O2Purity:95%Color and Shape:SolidMolecular weight:224.25464-Phenylcinnamic acid
CAS:4-Phenylcinnamic acidFormula:C15H12O2Purity:95%Color and Shape: white powderMolecular weight:224.25g/mol3-([1,1′-Biphenyl]-4-yl)acrylic acid
CAS:Formula:C15H12O2Purity:95%Color and Shape:SolidMolecular weight:224.2594-Phenylcinnamic acid
CAS:4-Phenylcinnamic acid is a prenylated aromatic compound that is used as a chromatographic stationary phase. It has been shown to inhibit the activity of tyrosinase and thus may be used for the treatment of hyperpigmentation disorders such as melasma. 4-Phenylcinnamic acid interacts with piperidine and inhibits its activity, which may lead to new drug development. Molecular modelling of 4-phenylcinnamic acid has shown that it is possible to introduce functional groups into the molecule, making it more reactive. The introduction of biphenyl derivatives may improve the lipophilicity of this molecule.
Formula:C15H12O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:224.25 g/mol




